![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Red Spot.JPG | 2006-01-10 09:12 | 16K | |
| Red Spot.xls | 2006-01-10 09:13 | 24K | |
| Red Spot ws.doc | 2006-01-10 09:13 | 89K | |
| Make a Copy.xls | 2006-01-10 09:29 | 42K | |
| Multiples.xls | 2006-01-10 09:30 | 19K | |
| Multiples Chain.xls | 2006-01-10 09:30 | 16K | |
| Interactive Number Pattern.xls | 2006-01-10 09:30 | 22K | |
| up&down game.xls | 2006-01-10 09:32 | 15K | |
| up&down game (Structure 1).xls | 2006-01-10 09:32 | 15K | |
| up&down game (Structure 2).xls | 2006-01-10 09:32 | 15K | |
| Inserting an Increment Button.doc | 2006-01-10 09:39 | 140K | |
| Making the Up & Down GameX.doc | 2006-01-10 09:40 | 416K | |
| Speed, Distance and Time Problems.doc | 2006-01-10 09:41 | 49K | |
| Student ws for Walk AtX.doc | 2006-01-10 09:41 | 24K | |
| Volume problems.doc | 2006-01-10 09:44 | 34K | |
| take three from five.xls | 2006-01-10 09:53 | 15K | |