![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| icon.jpg | 2018-02-12 16:45 | 2.8K | |
| CrossCut.xls | 2005-11-13 19:03 | 15K | |
| ItAddsUp.xls | 2005-11-13 19:04 | 15K | |
| up&down game (Structure 1).xls | 2005-11-13 19:04 | 15K | |
| up&down game (Structure 2).xls | 2005-11-13 19:04 | 15K | |
| Haitch.xls | 2005-11-13 19:03 | 16K | |
| Deduce.xls | 2005-11-13 19:03 | 17K | |
| Equalising.xls | 2005-11-13 19:03 | 17K | |
| The Median Five.doc | 2005-11-13 19:04 | 28K | |
| Making the Up & Down Game.doc | 2005-11-13 19:04 | 415K | |